C30H28N2O7S — CID 18871431
ethyl 4-[[4-[[(5Z)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate (PubChem CID 18871431) has the molecular formula C30H28N2O7S and a molecular weight of 560.63 g/mol. Its IUPAC name is ethyl 4-[[4-[[(5Z)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[[(5Z)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 18871431 |
| Molecular Formula | C30H28N2O7S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | ethyl 4-[[4-[[(5Z)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(CN3C(=O)S/C(=C\c4ccc(OCC)c(OC)c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O7S/c1-4-38-24-15-8-20(16-25(24)37-3)17-26-28(34)32(30(36)40-26)18-19-6-9-21(10-7-19)27(33)31-23-13-11-22(12-14-23)29(35)39-5-2/h6-17H,4-5,18H2,1-3H3,(H,31,33)/b26-17- |
| InChIKey | LZBXIDGUGMOXHB-ONUIUJJFSA-N |
| XLogP | 5.76 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|