C23H22N2O7S — CID 16632153
ethyl 4-[[2-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 16632153) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is ethyl 4-[[2-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16632153 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | ethyl 4-[[2-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccc(O)c(OCC)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H22N2O7S/c1-3-31-18-11-14(5-10-17(18)26)12-19-21(28)25(23(30)33-19)13-20(27)24-16-8-6-15(7-9-16)22(29)32-4-2/h5-12,26H,3-4,13H2,1-2H3,(H,24,27)/b19-12- |
| InChIKey | RCHJXFIUNDQBDC-UNOMPAQXSA-N |
| XLogP | 3.64 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|