C27H30N2O6S2 — CID 16630923
ethyl 4-[6-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate (PubChem CID 16630923) has the molecular formula C27H30N2O6S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is ethyl 4-[6-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate.
| Compound Name | ethyl 4-[6-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate |
|---|---|
| PubChem CID | 16630923 |
| Molecular Formula | C27H30N2O6S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | ethyl 4-[6-[(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCCCN2C(=O)/C(=C/c3ccc(O)c(OCC)c3)SC2=S)cc1 |
| InChI | InChI=1S/C27H30N2O6S2/c1-3-34-22-16-18(9-14-21(22)30)17-23-25(32)29(27(36)37-23)15-7-5-6-8-24(31)28-20-12-10-19(11-13-20)26(33)35-4-2/h9-14,16-17,30H,3-8,15H2,1-2H3,(H,28,31)/b23-17- |
| InChIKey | OZLZRMJETPVHPO-QJOMJCCJSA-N |
| XLogP | 5.37 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|