C26H26N2O6S2 — CID 4759340
ethyl 4-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate (PubChem CID 4759340) has the molecular formula C26H26N2O6S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is ethyl 4-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate.
| Compound Name | ethyl 4-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate |
|---|---|
| PubChem CID | 4759340 |
| Molecular Formula | C26H26N2O6S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | ethyl 4-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCCCN2C(=O)C(=Cc3ccc4c(c3)OCO4)SC2=S)cc1 |
| InChI | InChI=1S/C26H26N2O6S2/c1-2-32-25(31)18-8-10-19(11-9-18)27-23(29)6-4-3-5-13-28-24(30)22(36-26(28)35)15-17-7-12-20-21(14-17)34-16-33-20/h7-12,14-15H,2-6,13,16H2,1H3,(H,27,29) |
| InChIKey | QMDGZYDHZZNGMY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|