C23H22N2O6S2 — CID 4758243
N-(1,3-benzodioxol-5-yl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4758243) has the molecular formula C23H22N2O6S2 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4758243 |
| Molecular Formula | C23H22N2O6S2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCC(=O)Nc3ccc4c(c3)OCO4)C2=O)cc1OC |
| InChI | InChI=1S/C23H22N2O6S2/c1-28-16-7-5-14(10-18(16)29-2)11-20-22(27)25(23(32)33-20)9-3-4-21(26)24-15-6-8-17-19(12-15)31-13-30-17/h5-8,10-12H,3-4,9,13H2,1-2H3,(H,24,26) |
| InChIKey | HMYDAFHIQFJQAV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|