C23H21ClN2O4S2 — CID 4759321
6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)hexanamide (PubChem CID 4759321) has the molecular formula C23H21ClN2O4S2 and a molecular weight of 489.02 g/mol. Its IUPAC name is 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)hexanamide.
| Compound Name | 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)hexanamide |
|---|---|
| PubChem CID | 4759321 |
| Molecular Formula | C23H21ClN2O4S2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN2O4S2/c24-16-6-8-17(9-7-16)25-21(27)4-2-1-3-11-26-22(28)20(32-23(26)31)13-15-5-10-18-19(12-15)30-14-29-18/h5-10,12-13H,1-4,11,14H2,(H,25,27) |
| InChIKey | TYFJKHPKQOWFAP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|