C22H28N4O4S2 — CID 4759364
6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)hexanamide (PubChem CID 4759364) has the molecular formula C22H28N4O4S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)hexanamide.
| Compound Name | 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)hexanamide |
|---|---|
| PubChem CID | 4759364 |
| Molecular Formula | C22H28N4O4S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylpiperazin-1-yl)hexanamide |
| SMILES | CN1CCN(NC(=O)CCCCCN2C(=O)C(=Cc3ccc4c(c3)OCO4)SC2=S)CC1 |
| InChI | InChI=1S/C22H28N4O4S2/c1-24-9-11-25(12-10-24)23-20(27)5-3-2-4-8-26-21(28)19(32-22(26)31)14-16-6-7-17-18(13-16)30-15-29-17/h6-7,13-14H,2-5,8-12,15H2,1H3,(H,23,27) |
| InChIKey | JGEPPAJBTNKTLM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|