C24H22ClN3O5S2 — CID 4759394
N'-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-2-chlorobenzohydrazide (PubChem CID 4759394) has the molecular formula C24H22ClN3O5S2 and a molecular weight of 532.04 g/mol. Its IUPAC name is N'-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-2-chlorobenzohydrazide.
| Compound Name | N'-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 4759394 |
| Molecular Formula | C24H22ClN3O5S2 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N'-[6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-2-chlorobenzohydrazide |
| SMILES | O=C(CCCCCN1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C24H22ClN3O5S2/c25-17-7-4-3-6-16(17)22(30)27-26-21(29)8-2-1-5-11-28-23(31)20(35-24(28)34)13-15-9-10-18-19(12-15)33-14-32-18/h3-4,6-7,9-10,12-13H,1-2,5,8,11,14H2,(H,26,29)(H,27,30) |
| InChIKey | QVKRVOGLHFEBKE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|