C25H24ClN3O5S2 — CID 4759527
methyl 4-[[3-[6-[2-(2-chlorobenzoyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 4759527) has the molecular formula C25H24ClN3O5S2 and a molecular weight of 546.07 g/mol. Its IUPAC name is methyl 4-[[3-[6-[2-(2-chlorobenzoyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3-[6-[2-(2-chlorobenzoyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4759527 |
| Molecular Formula | C25H24ClN3O5S2 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | methyl 4-[[3-[6-[2-(2-chlorobenzoyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2SC(=S)N(CCCCCC(=O)NNC(=O)c3ccccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C25H24ClN3O5S2/c1-34-24(33)17-12-10-16(11-13-17)15-20-23(32)29(25(35)36-20)14-6-2-3-9-21(30)27-28-22(31)18-7-4-5-8-19(18)26/h4-5,7-8,10-13,15H,2-3,6,9,14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | WJDQOPIQKHSZCE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|