C24H25N3O6S3 — CID 4759538
methyl 4-[[3-[6-[2-(benzenesulfonyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 4759538) has the molecular formula C24H25N3O6S3 and a molecular weight of 547.68 g/mol. Its IUPAC name is methyl 4-[[3-[6-[2-(benzenesulfonyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3-[6-[2-(benzenesulfonyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4759538 |
| Molecular Formula | C24H25N3O6S3 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | methyl 4-[[3-[6-[2-(benzenesulfonyl)hydrazinyl]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2SC(=S)N(CCCCCC(=O)NNS(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H25N3O6S3/c1-33-23(30)18-13-11-17(12-14-18)16-20-22(29)27(24(34)35-20)15-7-3-6-10-21(28)25-26-36(31,32)19-8-4-2-5-9-19/h2,4-5,8-9,11-14,16,26H,3,6-7,10,15H2,1H3,(H,25,28) |
| InChIKey | ZEXXTKUVSQCRPD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|