C18H17N3O5S3 — CID 6204370
N'-(benzenesulfonyl)-4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide (PubChem CID 6204370) has the molecular formula C18H17N3O5S3 and a molecular weight of 451.55 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide.
| Compound Name | N'-(benzenesulfonyl)-4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
|---|---|
| PubChem CID | 6204370 |
| Molecular Formula | C18H17N3O5S3 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N'-(benzenesulfonyl)-4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
| SMILES | O=C(CCCN1C(=O)/C(=C\c2ccco2)SC1=S)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O5S3/c22-16(19-20-29(24,25)14-7-2-1-3-8-14)9-4-10-21-17(23)15(28-18(21)27)12-13-6-5-11-26-13/h1-3,5-8,11-12,20H,4,9-10H2,(H,19,22)/b15-12+ |
| InChIKey | PSBOOYZHPWYWBL-NTCAYCPXSA-N |
| XLogP | 2.27 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|