C18H14ClN3O4S2 — CID 4759867
2-chloro-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide (PubChem CID 4759867) has the molecular formula C18H14ClN3O4S2 and a molecular weight of 435.91 g/mol. Its IUPAC name is 2-chloro-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 4759867 |
| Molecular Formula | C18H14ClN3O4S2 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-chloro-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccco2)SC1=S)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H14ClN3O4S2/c19-13-6-2-1-5-12(13)16(24)21-20-15(23)7-8-22-17(25)14(28-18(22)27)10-11-4-3-9-26-11/h1-6,9-10H,7-8H2,(H,20,23)(H,21,24) |
| InChIKey | RDTBJQPFCWHOIS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|