C19H17N3O5S2 — CID 4759865
N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-methoxybenzohydrazide (PubChem CID 4759865) has the molecular formula C19H17N3O5S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-methoxybenzohydrazide.
| Compound Name | N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 4759865 |
| Molecular Formula | C19H17N3O5S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNC(=O)CCN1C(=O)C(=Cc2ccco2)SC1=S |
| InChI | InChI=1S/C19H17N3O5S2/c1-26-14-7-3-2-6-13(14)17(24)21-20-16(23)8-9-22-18(25)15(29-19(22)28)11-12-5-4-10-27-12/h2-7,10-11H,8-9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | OFQHXBZFEKVGGB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|