C17H14N4O4S2 — CID 4759877
N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-4-carbohydrazide (PubChem CID 4759877) has the molecular formula C17H14N4O4S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 4759877 |
| Molecular Formula | C17H14N4O4S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]pyridine-4-carbohydrazide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccco2)SC1=S)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C17H14N4O4S2/c22-14(19-20-15(23)11-3-6-18-7-4-11)5-8-21-16(24)13(27-17(21)26)10-12-2-1-9-25-12/h1-4,6-7,9-10H,5,8H2,(H,19,22)(H,20,23) |
| InChIKey | JLFQMBFPBSZNBF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|