C19H16BrN3O4S2 — CID 6204364
2-bromo-N'-[4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide (PubChem CID 6204364) has the molecular formula C19H16BrN3O4S2 and a molecular weight of 494.39 g/mol. Its IUPAC name is 2-bromo-N'-[4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide.
| Compound Name | 2-bromo-N'-[4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 6204364 |
| Molecular Formula | C19H16BrN3O4S2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 2-bromo-N'-[4-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide |
| SMILES | O=C(CCCN1C(=O)/C(=C\c2ccco2)SC1=S)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C19H16BrN3O4S2/c20-14-7-2-1-6-13(14)17(25)22-21-16(24)8-3-9-23-18(26)15(29-19(23)28)11-12-5-4-10-27-12/h1-2,4-7,10-11H,3,8-9H2,(H,21,24)(H,22,25)/b15-11+ |
| InChIKey | NCWCXDPRKQEJSU-RVDMUPIBSA-N |
| XLogP | 3.48 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|