C22H18N4O6S4 — CID 4759896
3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]propanehydrazide (PubChem CID 4759896) has the molecular formula C22H18N4O6S4 and a molecular weight of 562.68 g/mol. Its IUPAC name is 3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]propanehydrazide.
| Compound Name | 3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 4759896 |
| Molecular Formula | C22H18N4O6S4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | 3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-[3-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]propanehydrazide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccco2)SC1=S)NNC(=O)CCN1C(=O)C(=Cc2ccco2)SC1=S |
| InChI | InChI=1S/C22H18N4O6S4/c27-17(5-7-25-19(29)15(35-21(25)33)11-13-3-1-9-31-13)23-24-18(28)6-8-26-20(30)16(36-22(26)34)12-14-4-2-10-32-14/h1-4,9-12H,5-8H2,(H,23,27)(H,24,28) |
| InChIKey | NHRTZUCWHIVCRH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|