C18H15N3O4S3 — CID 6204146
2-methoxy-N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]benzohydrazide (PubChem CID 6204146) has the molecular formula C18H15N3O4S3 and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-methoxy-N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]benzohydrazide.
| Compound Name | 2-methoxy-N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 6204146 |
| Molecular Formula | C18H15N3O4S3 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 2-methoxy-N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]benzohydrazide |
| SMILES | COc1ccccc1C(=O)NNC(=O)CN1C(=O)/C(=C\c2cccs2)SC1=S |
| InChI | InChI=1S/C18H15N3O4S3/c1-25-13-7-3-2-6-12(13)16(23)20-19-15(22)10-21-17(24)14(28-18(21)26)9-11-5-4-8-27-11/h2-9H,10H2,1H3,(H,19,22)(H,20,23)/b14-9+ |
| InChIKey | ASTCTBWGYVTRBV-NTEUORMPSA-N |
| XLogP | 2.42 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|