C16H12N4O3S3 — CID 7658332
N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]pyridine-4-carbohydrazide (PubChem CID 7658332) has the molecular formula C16H12N4O3S3 and a molecular weight of 404.50 g/mol. Its IUPAC name is N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 7658332 |
| Molecular Formula | C16H12N4O3S3 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | N'-[2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetyl]pyridine-4-carbohydrazide |
| SMILES | O=C(CN1C(=O)/C(=C\c2cccs2)SC1=S)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C16H12N4O3S3/c21-13(18-19-14(22)10-3-5-17-6-4-10)9-20-15(23)12(26-16(20)24)8-11-2-1-7-25-11/h1-8H,9H2,(H,18,21)(H,19,22)/b12-8+ |
| InChIKey | FHYIFFIYOMVGOF-XYOKQWHBSA-N |
| XLogP | 1.81 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|