C16H16N4O2S3 — CID 6237218
N-(3-imidazol-1-ylpropyl)-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide (PubChem CID 6237218) has the molecular formula C16H16N4O2S3 and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 6237218 |
| Molecular Formula | C16H16N4O2S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2cccs2)SC1=S)NCCCn1ccnc1 |
| InChI | InChI=1S/C16H16N4O2S3/c21-14(18-4-2-6-19-7-5-17-11-19)10-20-15(22)13(25-16(20)23)9-12-3-1-8-24-12/h1,3,5,7-9,11H,2,4,6,10H2,(H,18,21)/b13-9- |
| InChIKey | YJEDDMOJWGKPOQ-LCYFTJDESA-N |
| XLogP | 2.35 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|