C20H21ClN4O2S2 — CID 6225587
4-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-imidazol-1-ylpropyl)butanamide (PubChem CID 6225587) has the molecular formula C20H21ClN4O2S2 and a molecular weight of 449.00 g/mol. Its IUPAC name is 4-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-imidazol-1-ylpropyl)butanamide.
| Compound Name | 4-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-imidazol-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 6225587 |
| Molecular Formula | C20H21ClN4O2S2 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-imidazol-1-ylpropyl)butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2ccccc2Cl)SC1=S)NCCCn1ccnc1 |
| InChI | InChI=1S/C20H21ClN4O2S2/c21-16-6-2-1-5-15(16)13-17-19(27)25(20(28)29-17)11-3-7-18(26)23-8-4-10-24-12-9-22-14-24/h1-2,5-6,9,12-14H,3-4,7-8,10-11H2,(H,23,26)/b17-13- |
| InChIKey | FMILKTBUGHVVCT-LGMDPLHJSA-N |
| XLogP | 3.72 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|