C18H21ClN2O2S2 — CID 6205005
N-butyl-4-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 6205005) has the molecular formula C18H21ClN2O2S2 and a molecular weight of 396.97 g/mol. Its IUPAC name is N-butyl-4-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-butyl-4-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 6205005 |
| Molecular Formula | C18H21ClN2O2S2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-butyl-4-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CCCCNC(=O)CCCN1C(=O)/C(=C\c2ccccc2Cl)SC1=S |
| InChI | InChI=1S/C18H21ClN2O2S2/c1-2-3-10-20-16(22)9-6-11-21-17(23)15(25-18(21)24)12-13-7-4-5-8-14(13)19/h4-5,7-8,12H,2-3,6,9-11H2,1H3,(H,20,22)/b15-12+ |
| InChIKey | QSIPNFJIMVYNGQ-NTCAYCPXSA-N |
| XLogP | 4.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|