C20H22Cl2N2O4S2 — CID 16630513
6-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid (PubChem CID 16630513) has the molecular formula C20H22Cl2N2O4S2 and a molecular weight of 489.45 g/mol. Its IUPAC name is 6-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid.
| Compound Name | 6-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 16630513 |
| Molecular Formula | C20H22Cl2N2O4S2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 6-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCCN1C(=O)/C(=C/c2cccc(Cl)c2Cl)SC1=S |
| InChI | InChI=1S/C20H22Cl2N2O4S2/c21-14-7-4-6-13(18(14)22)12-15-19(28)24(20(29)30-15)11-5-8-16(25)23-10-3-1-2-9-17(26)27/h4,6-7,12H,1-3,5,8-11H2,(H,23,25)(H,26,27)/b15-12- |
| InChIKey | AVKSSWVUCKFXMD-QINSGFPZSA-N |
| XLogP | 4.74 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|