C22H21Cl2N3O4S3 — CID 16631013
6-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)hexanamide (PubChem CID 16631013) has the molecular formula C22H21Cl2N3O4S3 and a molecular weight of 558.53 g/mol. Its IUPAC name is 6-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)hexanamide.
| Compound Name | 6-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)hexanamide |
|---|---|
| PubChem CID | 16631013 |
| Molecular Formula | C22H21Cl2N3O4S3 |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 557.01 |
| IUPAC Name | 6-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)hexanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCCCCN2C(=O)/C(=C/c3cccc(Cl)c3Cl)SC2=S)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O4S3/c23-17-6-4-5-14(20(17)24)13-18-21(29)27(22(32)33-18)12-3-1-2-7-19(28)26-15-8-10-16(11-9-15)34(25,30)31/h4-6,8-11,13H,1-3,7,12H2,(H,26,28)(H2,25,30,31)/b18-13- |
| InChIKey | ZIBUNJDWXLOHSN-AQTBWJFISA-N |
| XLogP | 5.04 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|