C19H17N3O5S3 — CID 16629843
3-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 16629843) has the molecular formula C19H17N3O5S3 and a molecular weight of 463.56 g/mol. Its IUPAC name is 3-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 16629843 |
| Molecular Formula | C19H17N3O5S3 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 3-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C/c3ccccc3O)SC2=S)cc1 |
| InChI | InChI=1S/C19H17N3O5S3/c20-30(26,27)14-7-5-13(6-8-14)21-17(24)9-10-22-18(25)16(29-19(22)28)11-12-3-1-2-4-15(12)23/h1-8,11,23H,9-10H2,(H,21,24)(H2,20,26,27)/b16-11- |
| InChIKey | LEYHIDQGJMRPQO-WJDWOHSUSA-N |
| XLogP | 2.27 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|