C21H21N3O7S3 — CID 16629844
3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 16629844) has the molecular formula C21H21N3O7S3 and a molecular weight of 523.61 g/mol. Its IUPAC name is 3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 16629844 |
| Molecular Formula | C21H21N3O7S3 |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCC(=O)Nc3ccc(S(N)(=O)=O)cc3)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C21H21N3O7S3/c1-30-15-9-12(10-16(31-2)19(15)26)11-17-20(27)24(21(32)33-17)8-7-18(25)23-13-3-5-14(6-4-13)34(22,28)29/h3-6,9-11,26H,7-8H2,1-2H3,(H,23,25)(H2,22,28,29)/b17-11- |
| InChIKey | GGZQNPMAAOCIQV-BOPFTXTBSA-N |
| XLogP | 2.29 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|