C17H15N3O5S3 — CID 16629856
3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 16629856) has the molecular formula C17H15N3O5S3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 16629856 |
| Molecular Formula | C17H15N3O5S3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C/c3ccco3)SC2=S)cc1 |
| InChI | InChI=1S/C17H15N3O5S3/c18-28(23,24)13-5-3-11(4-6-13)19-15(21)7-8-20-16(22)14(27-17(20)26)10-12-2-1-9-25-12/h1-6,9-10H,7-8H2,(H,19,21)(H2,18,23,24)/b14-10- |
| InChIKey | VLWVBQWISKQOAK-UVTDQMKNSA-N |
| XLogP | 2.16 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|