C16H13N3O5S3 — CID 16629316
2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16629316) has the molecular formula C16H13N3O5S3 and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16629316 |
| Molecular Formula | C16H13N3O5S3 |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)/C(=C/c3ccco3)SC2=S)cc1 |
| InChI | InChI=1S/C16H13N3O5S3/c17-27(22,23)12-5-3-10(4-6-12)18-14(20)9-19-15(21)13(26-16(19)25)8-11-2-1-7-24-11/h1-8H,9H2,(H,18,20)(H2,17,22,23)/b13-8- |
| InChIKey | PJDJFGWPLBDEEK-JYRVWZFOSA-N |
| XLogP | 1.77 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|