C18H13Cl2N3O4S3 — CID 16629306
2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16629306) has the molecular formula C18H13Cl2N3O4S3 and a molecular weight of 502.43 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16629306 |
| Molecular Formula | C18H13Cl2N3O4S3 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 500.94 |
| IUPAC Name | 2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)/C(=C/c3cccc(Cl)c3Cl)SC2=S)cc1 |
| InChI | InChI=1S/C18H13Cl2N3O4S3/c19-13-3-1-2-10(16(13)20)8-14-17(25)23(18(28)29-14)9-15(24)22-11-4-6-12(7-5-11)30(21,26)27/h1-8H,9H2,(H,22,24)(H2,21,26,27)/b14-8- |
| InChIKey | AIMISWOUTIBMBX-ZSOIEALJSA-N |
| XLogP | 3.48 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|