C21H16Cl2N2O5S — CID 16632161
ethyl 4-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 16632161) has the molecular formula C21H16Cl2N2O5S and a molecular weight of 479.34 g/mol. Its IUPAC name is ethyl 4-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16632161 |
| Molecular Formula | C21H16Cl2N2O5S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | ethyl 4-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)S/C(=C\c3cccc(Cl)c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O5S/c1-2-30-20(28)12-6-8-14(9-7-12)24-17(26)11-25-19(27)16(31-21(25)29)10-13-4-3-5-15(22)18(13)23/h3-10H,2,11H2,1H3,(H,24,26)/b16-10- |
| InChIKey | ZCOSTVCFSYBDKO-YBEGLDIGSA-N |
| XLogP | 4.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|