C21H17Cl2N3O5 — CID 16632836
ethyl 4-[[2-[(4Z)-4-[(2,3-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 16632836) has the molecular formula C21H17Cl2N3O5 and a molecular weight of 462.29 g/mol. Its IUPAC name is ethyl 4-[[2-[(4Z)-4-[(2,3-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4Z)-4-[(2,3-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16632836 |
| Molecular Formula | C21H17Cl2N3O5 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | ethyl 4-[[2-[(4Z)-4-[(2,3-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)N/C(=C\c3cccc(Cl)c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O5/c1-2-31-20(29)12-6-8-14(9-7-12)24-17(27)11-26-19(28)16(25-21(26)30)10-13-4-3-5-15(22)18(13)23/h3-10H,2,11H2,1H3,(H,24,27)(H,25,30)/b16-10- |
| InChIKey | BQOGXJFORGCMPX-YBEGLDIGSA-N |
| XLogP | 3.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|