C29H23N3O5 — CID 16632852
ethyl 4-[[2-[(4Z)-4-(anthracen-9-ylmethylidene)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 16632852) has the molecular formula C29H23N3O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is ethyl 4-[[2-[(4Z)-4-(anthracen-9-ylmethylidene)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4Z)-4-(anthracen-9-ylmethylidene)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16632852 |
| Molecular Formula | C29H23N3O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | ethyl 4-[[2-[(4Z)-4-(anthracen-9-ylmethylidene)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)N/C(=C\c3c4ccccc4cc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C29H23N3O5/c1-2-37-28(35)18-11-13-21(14-12-18)30-26(33)17-32-27(34)25(31-29(32)36)16-24-22-9-5-3-7-19(22)15-20-8-4-6-10-23(20)24/h3-16H,2,17H2,1H3,(H,30,33)(H,31,36)/b25-16- |
| InChIKey | FHFULHDUVRKFDI-XYGWBWBKSA-N |
| XLogP | 4.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|