C26H21N3O4 — CID 126023012
2-[(4E)-2,5-dioxo-4-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]imidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126023012) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[(4E)-2,5-dioxo-4-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]imidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-2,5-dioxo-4-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]imidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126023012 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[(4E)-2,5-dioxo-4-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]imidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | C#CCOc1ccc2ccccc2c1/C=C1/NC(=O)N(CC(=O)Nc2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C26H21N3O4/c1-3-14-33-23-13-10-18-6-4-5-7-20(18)21(23)15-22-25(31)29(26(32)28-22)16-24(30)27-19-11-8-17(2)9-12-19/h1,4-13,15H,14,16H2,2H3,(H,27,30)(H,28,32)/b22-15+ |
| InChIKey | STPNZSUAJMFYHG-PXLXIMEGSA-N |
| XLogP | 3.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|