C30H24N4O6 — CID 126104066
N-(3-methylphenyl)-2-[(4E)-4-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126104066) has the molecular formula C30H24N4O6 and a molecular weight of 536.54 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[(4E)-4-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[(4E)-4-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126104066 |
| Molecular Formula | C30H24N4O6 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-(3-methylphenyl)-2-[(4E)-4-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3c(OCc4cccc([N+](=O)[O-])c4)ccc4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C30H24N4O6/c1-19-6-4-9-22(14-19)31-28(35)17-33-29(36)26(32-30(33)37)16-25-24-11-3-2-8-21(24)12-13-27(25)40-18-20-7-5-10-23(15-20)34(38)39/h2-16H,17-18H2,1H3,(H,31,35)(H,32,37)/b26-16+ |
| InChIKey | NJULSTSAMWTDNV-WGOQTCKBSA-N |
| XLogP | 5.17 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|