C29H27BrN4O7 — CID 126248755
2-[(4E)-4-[[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 126248755) has the molecular formula C29H27BrN4O7 and a molecular weight of 623.46 g/mol. Its IUPAC name is 2-[(4E)-4-[[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126248755 |
| Molecular Formula | C29H27BrN4O7 |
| Molecular Weight | 623.46 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | 2-[(4E)-4-[[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3CC)C2=O)c(Br)cc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27BrN4O7/c1-3-19-9-5-6-11-23(19)31-27(35)16-33-28(36)24(32-29(33)37)13-20-14-25(40-4-2)26(15-22(20)30)41-17-18-8-7-10-21(12-18)34(38)39/h5-15H,3-4,16-17H2,1-2H3,(H,31,35)(H,32,37)/b24-13+ |
| InChIKey | OTCJOROAPZYZFY-ZMOGYAJESA-N |
| XLogP | 5.43 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|