C27H23BrFN3O5 — CID 126225172
2-[(4E)-4-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126225172) has the molecular formula C27H23BrFN3O5 and a molecular weight of 568.40 g/mol. Its IUPAC name is 2-[(4E)-4-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126225172 |
| Molecular Formula | C27H23BrFN3O5 |
| Molecular Weight | 568.40 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | 2-[(4E)-4-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)c(Br)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H23BrFN3O5/c1-16-6-5-7-17(10-16)15-37-24-13-19(28)18(12-23(24)36-2)11-22-26(34)32(27(35)31-22)14-25(33)30-21-9-4-3-8-20(21)29/h3-13H,14-15H2,1-2H3,(H,30,33)(H,31,35)/b22-11+ |
| InChIKey | ZEFSATAGDRVOSC-SSDVNMTOSA-N |
| XLogP | 5.02 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|