C26H21FN4O7 — CID 126218122
N-(2-fluorophenyl)-2-[(4E)-4-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126218122) has the molecular formula C26H21FN4O7 and a molecular weight of 520.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(4E)-4-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(4E)-4-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126218122 |
| Molecular Formula | C26H21FN4O7 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(4E)-4-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H21FN4O7/c1-37-22-12-17(21(31(35)36)13-23(22)38-15-16-7-3-2-4-8-16)11-20-25(33)30(26(34)29-20)14-24(32)28-19-10-6-5-9-18(19)27/h2-13H,14-15H2,1H3,(H,28,32)(H,29,34)/b20-11+ |
| InChIKey | KSRVLMWBFOACDF-RGVLZGJSSA-N |
| XLogP | 3.85 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|