C28H25BrN4O7 — CID 126251423
2-[(4E)-4-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 126251423) has the molecular formula C28H25BrN4O7 and a molecular weight of 609.43 g/mol. Its IUPAC name is 2-[(4E)-4-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126251423 |
| Molecular Formula | C28H25BrN4O7 |
| Molecular Weight | 609.43 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | 2-[(4E)-4-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(OC)c(OCc3ccc([N+](=O)[O-])cc3)cc2Br)C1=O |
| InChI | InChI=1S/C28H25BrN4O7/c1-3-18-6-4-5-7-22(18)30-26(34)15-32-27(35)23(31-28(32)36)12-19-13-24(39-2)25(14-21(19)29)40-16-17-8-10-20(11-9-17)33(37)38/h4-14H,3,15-16H2,1-2H3,(H,30,34)(H,31,36)/b23-12+ |
| InChIKey | PPVXZDKYFCIUNA-FSJBWODESA-N |
| XLogP | 5.04 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|