C26H22N4O7 — CID 126236866
N-(2-methoxyphenyl)-2-[(4E)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126236866) has the molecular formula C26H22N4O7 and a molecular weight of 502.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[(4E)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[(4E)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126236866 |
| Molecular Formula | C26H22N4O7 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[(4E)-4-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2ccc(OCc3ccc([N+](=O)[O-])cc3)cc2)C1=O |
| InChI | InChI=1S/C26H22N4O7/c1-36-23-5-3-2-4-21(23)27-24(31)15-29-25(32)22(28-26(29)33)14-17-8-12-20(13-9-17)37-16-18-6-10-19(11-7-18)30(34)35/h2-14H,15-16H2,1H3,(H,27,31)(H,28,33)/b22-14+ |
| InChIKey | FGPLCMJWMWWGME-HYARGMPZSA-N |
| XLogP | 3.71 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|