C27H23Br2N3O5 — CID 126241686
2-[(4E)-4-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126241686) has the molecular formula C27H23Br2N3O5 and a molecular weight of 629.31 g/mol. Its IUPAC name is 2-[(4E)-4-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126241686 |
| Molecular Formula | C27H23Br2N3O5 |
| Molecular Weight | 629.31 g/mol |
| Exact Mass | 627.00 |
| IUPAC Name | 2-[(4E)-4-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(Br)c(OCc3ccc(C)cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C27H23Br2N3O5/c1-16-7-9-17(10-8-16)15-37-25-19(28)11-18(12-20(25)29)13-22-26(34)32(27(35)31-22)14-24(33)30-21-5-3-4-6-23(21)36-2/h3-13H,14-15H2,1-2H3,(H,30,33)(H,31,35)/b22-13+ |
| InChIKey | BRUHUEGESQPBIU-LPYMAVHISA-N |
| XLogP | 5.64 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.31 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|