C23H22BrN3O8 — CID 126251820
methyl 2-[2-bromo-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126251820) has the molecular formula C23H22BrN3O8 and a molecular weight of 548.35 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126251820 |
| Molecular Formula | C23H22BrN3O8 |
| Molecular Weight | 548.35 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | methyl 2-[2-bromo-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Br)cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)cc1OC |
| InChI | InChI=1S/C23H22BrN3O8/c1-32-17-7-5-4-6-15(17)25-19(28)11-27-22(30)16(26-23(27)31)9-13-8-14(24)21(18(10-13)33-2)35-12-20(29)34-3/h4-10H,11-12H2,1-3H3,(H,25,28)(H,26,31)/b16-9+ |
| InChIKey | WWPGKBJQRVNRAC-CXUHLZMHSA-N |
| XLogP | 2.55 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|