C23H21BrClN3O7 — CID 126254916
ethyl 2-[2-bromo-6-chloro-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126254916) has the molecular formula C23H21BrClN3O7 and a molecular weight of 566.79 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-chloro-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-chloro-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126254916 |
| Molecular Formula | C23H21BrClN3O7 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | ethyl 2-[2-bromo-6-chloro-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)cc1Br |
| InChI | InChI=1S/C23H21BrClN3O7/c1-3-34-20(30)12-35-21-14(24)8-13(9-15(21)25)10-17-22(31)28(23(32)27-17)11-19(29)26-16-6-4-5-7-18(16)33-2/h4-10H,3,11-12H2,1-2H3,(H,26,29)(H,27,32)/b17-10+ |
| InChIKey | IHVZVTYRHZFGKY-LICLKQGHSA-N |
| XLogP | 3.58 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|