C24H23Cl2N3O6 — CID 126254653
ethyl 2-[2,6-dichloro-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126254653) has the molecular formula C24H23Cl2N3O6 and a molecular weight of 520.37 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126254653 |
| Molecular Formula | C24H23Cl2N3O6 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3CC)C2=O)cc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O6/c1-3-15-7-5-6-8-18(15)27-20(30)12-29-23(32)19(28-24(29)33)11-14-9-16(25)22(17(26)10-14)35-13-21(31)34-4-2/h5-11H,3-4,12-13H2,1-2H3,(H,27,30)(H,28,33)/b19-11+ |
| InChIKey | KPKZWJQLPZBCBO-YBFXNURJSA-N |
| XLogP | 4.03 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|