C24H26ClN3O5 — CID 126227604
2-[(4E)-4-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 126227604) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is 2-[(4E)-4-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126227604 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 2-[(4E)-4-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3CC)C2=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C24H26ClN3O5/c1-4-16-9-7-8-10-18(16)26-21(29)14-28-23(30)19(27-24(28)31)12-15-11-17(25)22(33-6-3)20(13-15)32-5-2/h7-13H,4-6,14H2,1-3H3,(H,26,29)(H,27,31)/b19-12+ |
| InChIKey | PWMCWKRFJQGOCK-XDHOZWIPSA-N |
| XLogP | 4.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|