C24H24ClN3O8 — CID 126241535
ethyl 2-[2-chloro-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126241535) has the molecular formula C24H24ClN3O8 and a molecular weight of 517.92 g/mol. Its IUPAC name is ethyl 2-[2-chloro-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126241535 |
| Molecular Formula | C24H24ClN3O8 |
| Molecular Weight | 517.92 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | ethyl 2-[2-chloro-6-methoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)cc1OC |
| InChI | InChI=1S/C24H24ClN3O8/c1-4-35-21(30)13-36-22-15(25)9-14(11-19(22)34-3)10-17-23(31)28(24(32)27-17)12-20(29)26-16-7-5-6-8-18(16)33-2/h5-11H,4,12-13H2,1-3H3,(H,26,29)(H,27,32)/b17-10+ |
| InChIKey | OVSREVXIJNDNSK-LICLKQGHSA-N |
| XLogP | 2.83 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.92 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|