C26H21Cl2N3O5 — CID 126242659
2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126242659) has the molecular formula C26H21Cl2N3O5 and a molecular weight of 526.38 g/mol. Its IUPAC name is 2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126242659 |
| Molecular Formula | C26H21Cl2N3O5 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(Cl)c(OCc3ccccc3)c(Cl)c2)C1=O |
| InChI | InChI=1S/C26H21Cl2N3O5/c1-35-22-10-6-5-9-20(22)29-23(32)14-31-25(33)21(30-26(31)34)13-17-11-18(27)24(19(28)12-17)36-15-16-7-3-2-4-8-16/h2-13H,14-15H2,1H3,(H,29,32)(H,30,34)/b21-13+ |
| InChIKey | GTXXMFJSVPYIJY-FYJGNVAPSA-N |
| XLogP | 5.11 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|