C26H21Cl2N3O4 — CID 126111879
2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126111879) has the molecular formula C26H21Cl2N3O4 and a molecular weight of 510.38 g/mol. Its IUPAC name is 2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126111879 |
| Molecular Formula | C26H21Cl2N3O4 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-[(4E)-4-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3cc(Cl)c(OCc4ccccc4)c(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C26H21Cl2N3O4/c1-16-6-5-9-19(10-16)29-23(32)14-31-25(33)22(30-26(31)34)13-18-11-20(27)24(21(28)12-18)35-15-17-7-3-2-4-8-17/h2-13H,14-15H2,1H3,(H,29,32)(H,30,34)/b22-13+ |
| InChIKey | IQMNOJGEEVRSMY-LPYMAVHISA-N |
| XLogP | 5.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|