C26H20ClI2N3O4 — CID 126111925
2-[(4E)-4-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126111925) has the molecular formula C26H20ClI2N3O4 and a molecular weight of 727.72 g/mol. Its IUPAC name is 2-[(4E)-4-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126111925 |
| Molecular Formula | C26H20ClI2N3O4 |
| Molecular Weight | 727.72 g/mol |
| Exact Mass | 726.92 |
| IUPAC Name | 2-[(4E)-4-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3cc(I)c(OCc4ccc(Cl)cc4)c(I)c3)C2=O)c1 |
| InChI | InChI=1S/C26H20ClI2N3O4/c1-15-3-2-4-19(9-15)30-23(33)13-32-25(34)22(31-26(32)35)12-17-10-20(28)24(21(29)11-17)36-14-16-5-7-18(27)8-6-16/h2-12H,13-14H2,1H3,(H,30,33)(H,31,35)/b22-12+ |
| InChIKey | IWCIHQMDVWHNJS-WSDLNYQXSA-N |
| XLogP | 5.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|