C28H25FIN3O5 — CID 126106675
2-[(4E)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126106675) has the molecular formula C28H25FIN3O5 and a molecular weight of 629.43 g/mol. Its IUPAC name is 2-[(4E)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126106675 |
| Molecular Formula | C28H25FIN3O5 |
| Molecular Weight | 629.43 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | 2-[(4E)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3cccc(C)c3)C2=O)cc(I)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C28H25FIN3O5/c1-3-37-24-14-19(12-22(30)26(24)38-16-18-7-5-8-20(29)11-18)13-23-27(35)33(28(36)32-23)15-25(34)31-21-9-4-6-17(2)10-21/h4-14H,3,15-16H2,1-2H3,(H,31,34)(H,32,36)/b23-13+ |
| InChIKey | MUFCWHATGJVTNW-YDZHTSKRSA-N |
| XLogP | 5.25 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|