C29H26IN3O7 — CID 126029843
3-[[2-ethoxy-6-iodo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126029843) has the molecular formula C29H26IN3O7 and a molecular weight of 655.45 g/mol. Its IUPAC name is 3-[[2-ethoxy-6-iodo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-ethoxy-6-iodo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126029843 |
| Molecular Formula | C29H26IN3O7 |
| Molecular Weight | 655.45 g/mol |
| Exact Mass | 655.08 |
| IUPAC Name | 3-[[2-ethoxy-6-iodo-4-[(E)-[1-[2-(4-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccc(C)cc3)C2=O)cc(I)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C29H26IN3O7/c1-3-39-24-14-19(12-22(30)26(24)40-16-18-5-4-6-20(11-18)28(36)37)13-23-27(35)33(29(38)32-23)15-25(34)31-21-9-7-17(2)8-10-21/h4-14H,3,15-16H2,1-2H3,(H,31,34)(H,32,38)(H,36,37)/b23-13+ |
| InChIKey | ZWLSWLGXUCCKOQ-YDZHTSKRSA-N |
| XLogP | 4.81 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|