C29H25BrN2O7S — CID 6184775
3-[[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 6184775) has the molecular formula C29H25BrN2O7S and a molecular weight of 625.50 g/mol. Its IUPAC name is 3-[[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 6184775 |
| Molecular Formula | C29H25BrN2O7S |
| Molecular Weight | 625.50 g/mol |
| Exact Mass | 624.06 |
| IUPAC Name | 3-[[2-bromo-6-ethoxy-4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(C)cc3)C2=O)cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C29H25BrN2O7S/c1-3-38-23-13-19(12-22(30)26(23)39-16-18-5-4-6-20(11-18)28(35)36)14-24-27(34)32(29(37)40-24)15-25(33)31-21-9-7-17(2)8-10-21/h4-14H,3,15-16H2,1-2H3,(H,31,33)(H,35,36)/b24-14- |
| InChIKey | XSYFDYWQNIHTGU-OYKKKHCWSA-N |
| XLogP | 6.11 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|